C15H20O2 — CID 89171201
(1S,2R,6S)-4-cyclohexyl-1-methylspiro[bicyclo[4.1.0]hept-4-ene-2,2'-oxirane]-3-one (PubChem CID 89171201) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (1S,2R,6S)-4-cyclohexyl-1-methylspiro[bicyclo[4.1.0]hept-4-ene-2,2'-oxirane]-3-one.
| Compound Name | (1S,2R,6S)-4-cyclohexyl-1-methylspiro[bicyclo[4.1.0]hept-4-ene-2,2'-oxirane]-3-one |
|---|---|
| PubChem CID | 89171201 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (1S,2R,6S)-4-cyclohexyl-1-methylspiro[bicyclo[4.1.0]hept-4-ene-2,2'-oxirane]-3-one |
| SMILES | C[C@]12C[C@H]1C=C(C1CCCCC1)C(=O)[C@]21CO1 |
| InChI | InChI=1S/C15H20O2/c1-14-8-11(14)7-12(10-5-3-2-4-6-10)13(16)15(14)9-17-15/h7,10-11H,2-6,8-9H2,1H3/t11-,14+,15-/m1/s1 |
| InChIKey | WELCHCLEQZKDPS-BYCMXARLSA-N |
| XLogP | 2.87 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|