C7H10N2 — CID 89171243
5,7-dimethyl-2H-1,4-diazepine (PubChem CID 89171243) has the molecular formula C7H10N2 and a molecular weight of 122.17 g/mol. Its IUPAC name is 5,7-dimethyl-2H-1,4-diazepine.
| Compound Name | 5,7-dimethyl-2H-1,4-diazepine |
|---|---|
| PubChem CID | 89171243 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 5,7-dimethyl-2H-1,4-diazepine |
| SMILES | CC1=CC(C)=NCC=N1 |
| InChI | InChI=1S/C7H10N2/c1-6-5-7(2)9-4-3-8-6/h3,5H,4H2,1-2H3 |
| InChIKey | SMACFOSXBVIVDX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |