C26H40N6 — CID 89171591
(2E,4Z,7E,8Z,10E)-7-butan-2-ylidene-5-[(Z)-but-2-en-2-yl]-3-N,10-N-bis(4,5-dihydro-1H-imidazol-2-yl)dodeca-2,4,8,10-tetraene-3,10-diamine (PubChem CID 89171591) has the molecular formula C26H40N6 and a molecular weight of 436.65 g/mol. Its IUPAC name is (2E,4Z,7E,8Z,10E)-7-butan-2-ylidene-5-[(Z)-but-2-en-2-yl]-3-N,10-N-bis(4,5-dihydro-1H-imidazol-2-yl)dodeca-2,4,8,10-tetraene-3,10-diamine.
| Compound Name | (2E,4Z,7E,8Z,10E)-7-butan-2-ylidene-5-[(Z)-but-2-en-2-yl]-3-N,10-N-bis(4,5-dihydro-1H-imidazol-2-yl)dodeca-2,4,8,10-tetraene-3,10-diamine |
|---|---|
| PubChem CID | 89171591 |
| Molecular Formula | C26H40N6 |
| Molecular Weight | 436.65 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | (2E,4Z,7E,8Z,10E)-7-butan-2-ylidene-5-[(Z)-but-2-en-2-yl]-3-N,10-N-bis(4,5-dihydro-1H-imidazol-2-yl)dodeca-2,4,8,10-tetraene-3,10-diamine |
| SMILES | C/C=C(C)\C(=C/C(=C\C)NC1=NCCN1)CC(/C=C\C(=C/C)NC1=NCCN1)=C(/C)CC |
| InChI | InChI=1S/C26H40N6/c1-7-19(5)21(11-12-23(9-3)31-25-27-13-14-28-25)17-22(20(6)8-2)18-24(10-4)32-26-29-15-16-30-26/h8-12,18H,7,13-17H2,1-6H3,(H2,27,28,31)(H2,29,30,32)/b12-11-,20-8-,21-19-,22-18-,23-9+,24-10+ |
| InChIKey | XFGCUXUSSCGFQI-TWLAVZMJSA-N |
| XLogP | 4.46 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.65 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|