About 2-[(2E,4Z)-hexa-2,4-dien-3-yl]guanidine
2-[(2E,4Z)-hexa-2,4-dien-3-yl]guanidine (PubChem CID 89171592) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is 2-[(2E,4Z)-hexa-2,4-dien-3-yl]guanidine.
Molecular Properties
| Compound Name | 2-[(2E,4Z)-hexa-2,4-dien-3-yl]guanidine |
| PubChem CID | 89171592 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 2-[(2E,4Z)-hexa-2,4-dien-3-yl]guanidine |
| SMILES | C/C=C\C(=C/C)N=C(N)N |
| InChI | InChI=1S/C7H13N3/c1-3-5-6(4-2)10-7(8)9/h3-5H,1-2H3,(H4,8,9,10)/b5-3-,6-4+ |
| InChIKey | JGNOUMVCRBAXTM-CIIODKQPSA-N |
| XLogP | 0.74 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2E,4Z)-hexa-2,4-dien-3-yl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2E,4Z)-hexa-2,4-dien-3-yl]guanidine?
The IUPAC name of 2-[(2E,4Z)-hexa-2,4-dien-3-yl]guanidine (CID 89171592) is 2-[(2E,4Z)-hexa-2,4-dien-3-yl]guanidine.
What is the SMILES notation for 2-[(2E,4Z)-hexa-2,4-dien-3-yl]guanidine?
The canonical SMILES for 2-[(2E,4Z)-hexa-2,4-dien-3-yl]guanidine is C/C=C\C(=C/C)N=C(N)N.
What is the InChIKey of 2-[(2E,4Z)-hexa-2,4-dien-3-yl]guanidine?
The InChIKey is JGNOUMVCRBAXTM-CIIODKQPSA-N. The full InChI is InChI=1S/C7H13N3/c1-3-5-6(4-2)10-7(8)9/h3-5H,1-2H3,(H4,8,9,10)/b5-3-,6-4+.
What are the key properties of 2-[(2E,4Z)-hexa-2,4-dien-3-yl]guanidine?
2-[(2E,4Z)-hexa-2,4-dien-3-yl]guanidine has a molecular weight of 139.20 g/mol, XLogP of 0.74, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2E,4Z)-hexa-2,4-dien-3-yl]guanidine is sourced from PubChem (CID 89171592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).