C8H11F5O3 — CID 89172035
2-ethoxy-1,1,1,3,3-pentafluoro-3-prop-2-enoxypropan-2-ol (PubChem CID 89172035) has the molecular formula C8H11F5O3 and a molecular weight of 250.16 g/mol. Its IUPAC name is 2-ethoxy-1,1,1,3,3-pentafluoro-3-prop-2-enoxypropan-2-ol.
| Compound Name | 2-ethoxy-1,1,1,3,3-pentafluoro-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 89172035 |
| Molecular Formula | C8H11F5O3 |
| Molecular Weight | 250.16 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-ethoxy-1,1,1,3,3-pentafluoro-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOC(F)(F)C(O)(OCC)C(F)(F)F |
| InChI | InChI=1S/C8H11F5O3/c1-3-5-16-8(12,13)6(14,15-4-2)7(9,10)11/h3,14H,1,4-5H2,2H3 |
| InChIKey | HLEPUSOMPGXBTJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.16 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|