C11H12F8O4 — CID 89172038
[1,1,3,3,3-pentafluoro-2-hydroxy-2-(1,1,1-trifluoro-2-methylpropan-2-yl)oxypropyl] 2-methylprop-2-enoate (PubChem CID 89172038) has the molecular formula C11H12F8O4 and a molecular weight of 360.20 g/mol. Its IUPAC name is [1,1,3,3,3-pentafluoro-2-hydroxy-2-(1,1,1-trifluoro-2-methylpropan-2-yl)oxypropyl] 2-methylprop-2-enoate.
| Compound Name | [1,1,3,3,3-pentafluoro-2-hydroxy-2-(1,1,1-trifluoro-2-methylpropan-2-yl)oxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89172038 |
| Molecular Formula | C11H12F8O4 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | [1,1,3,3,3-pentafluoro-2-hydroxy-2-(1,1,1-trifluoro-2-methylpropan-2-yl)oxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(F)(F)C(O)(OC(C)(C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H12F8O4/c1-5(2)6(20)22-11(18,19)8(21,10(15,16)17)23-7(3,4)9(12,13)14/h21H,1H2,2-4H3 |
| InChIKey | XZNMCVITRIMJDI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|