About N-(2-amino-4-bromo-6-pyrimidin-2-ylphenyl)-2,2-dimethylpropanamide
N-(2-amino-4-bromo-6-pyrimidin-2-ylphenyl)-2,2-dimethylpropanamide (PubChem CID 89172260) has the molecular formula C15H17BrN4O
and a molecular weight of 349.23 g/mol. Its IUPAC name is N-(2-amino-4-bromo-6-pyrimidin-2-ylphenyl)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(2-amino-4-bromo-6-pyrimidin-2-ylphenyl)-2,2-dimethylpropanamide |
| PubChem CID | 89172260 |
| Molecular Formula | C15H17BrN4O |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | N-(2-amino-4-bromo-6-pyrimidin-2-ylphenyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1c(N)cc(Br)cc1-c1ncccn1 |
| InChI | InChI=1S/C15H17BrN4O/c1-15(2,3)14(21)20-12-10(7-9(16)8-11(12)17)13-18-5-4-6-19-13/h4-8H,17H2,1-3H3,(H,20,21) |
| InChIKey | HHFNNTICBCDLHN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(2-amino-4-bromo-6-pyrimidin-2-ylphenyl)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-4-bromo-6-pyrimidin-2-ylphenyl)-2,2-dimethylpropanamide?
The IUPAC name of N-(2-amino-4-bromo-6-pyrimidin-2-ylphenyl)-2,2-dimethylpropanamide (CID 89172260) is N-(2-amino-4-bromo-6-pyrimidin-2-ylphenyl)-2,2-dimethylpropanamide.
What is the SMILES notation for N-(2-amino-4-bromo-6-pyrimidin-2-ylphenyl)-2,2-dimethylpropanamide?
The canonical SMILES for N-(2-amino-4-bromo-6-pyrimidin-2-ylphenyl)-2,2-dimethylpropanamide is CC(C)(C)C(=O)Nc1c(N)cc(Br)cc1-c1ncccn1.
What is the InChIKey of N-(2-amino-4-bromo-6-pyrimidin-2-ylphenyl)-2,2-dimethylpropanamide?
The InChIKey is HHFNNTICBCDLHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17BrN4O/c1-15(2,3)14(21)20-12-10(7-9(16)8-11(12)17)13-18-5-4-6-19-13/h4-8H,17H2,1-3H3,(H,20,21).
What are the key properties of N-(2-amino-4-bromo-6-pyrimidin-2-ylphenyl)-2,2-dimethylpropanamide?
N-(2-amino-4-bromo-6-pyrimidin-2-ylphenyl)-2,2-dimethylpropanamide has a molecular weight of 349.23 g/mol, XLogP of 3.47, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-4-bromo-6-pyrimidin-2-ylphenyl)-2,2-dimethylpropanamide is sourced from PubChem (CID 89172260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).