About 2-(propan-2-ylamino)-1,3-benzoxazol-5-ol
2-(propan-2-ylamino)-1,3-benzoxazol-5-ol (PubChem CID 89172308) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-(propan-2-ylamino)-1,3-benzoxazol-5-ol.
Molecular Properties
| Compound Name | 2-(propan-2-ylamino)-1,3-benzoxazol-5-ol |
| PubChem CID | 89172308 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-(propan-2-ylamino)-1,3-benzoxazol-5-ol |
| SMILES | CC(C)Nc1nc2cc(O)ccc2o1 |
| InChI | InChI=1S/C10H12N2O2/c1-6(2)11-10-12-8-5-7(13)3-4-9(8)14-10/h3-6,13H,1-2H3,(H,11,12) |
| InChIKey | QLVBDYMWHIWKKB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(propan-2-ylamino)-1,3-benzoxazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(propan-2-ylamino)-1,3-benzoxazol-5-ol?
The IUPAC name of 2-(propan-2-ylamino)-1,3-benzoxazol-5-ol (CID 89172308) is 2-(propan-2-ylamino)-1,3-benzoxazol-5-ol.
What is the SMILES notation for 2-(propan-2-ylamino)-1,3-benzoxazol-5-ol?
The canonical SMILES for 2-(propan-2-ylamino)-1,3-benzoxazol-5-ol is CC(C)Nc1nc2cc(O)ccc2o1.
What is the InChIKey of 2-(propan-2-ylamino)-1,3-benzoxazol-5-ol?
The InChIKey is QLVBDYMWHIWKKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c1-6(2)11-10-12-8-5-7(13)3-4-9(8)14-10/h3-6,13H,1-2H3,(H,11,12).
What are the key properties of 2-(propan-2-ylamino)-1,3-benzoxazol-5-ol?
2-(propan-2-ylamino)-1,3-benzoxazol-5-ol has a molecular weight of 192.22 g/mol, XLogP of 2.35, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(propan-2-ylamino)-1,3-benzoxazol-5-ol is sourced from PubChem (CID 89172308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).