About 3-N-phenyl-1H-indazole-3,5-diamine
3-N-phenyl-1H-indazole-3,5-diamine (PubChem CID 89172388) has the molecular formula C13H12N4
and a molecular weight of 224.27 g/mol. Its IUPAC name is 3-N-phenyl-1H-indazole-3,5-diamine.
Molecular Properties
| Compound Name | 3-N-phenyl-1H-indazole-3,5-diamine |
| PubChem CID | 89172388 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 3-N-phenyl-1H-indazole-3,5-diamine |
| SMILES | Nc1ccc2[nH]nc(Nc3ccccc3)c2c1 |
| InChI | InChI=1S/C13H12N4/c14-9-6-7-12-11(8-9)13(17-16-12)15-10-4-2-1-3-5-10/h1-8H,14H2,(H2,15,16,17) |
| InChIKey | SSTUKIRKGGVTDU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-N-phenyl-1H-indazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-phenyl-1H-indazole-3,5-diamine?
The IUPAC name of 3-N-phenyl-1H-indazole-3,5-diamine (CID 89172388) is 3-N-phenyl-1H-indazole-3,5-diamine.
What is the SMILES notation for 3-N-phenyl-1H-indazole-3,5-diamine?
The canonical SMILES for 3-N-phenyl-1H-indazole-3,5-diamine is Nc1ccc2[nH]nc(Nc3ccccc3)c2c1.
What is the InChIKey of 3-N-phenyl-1H-indazole-3,5-diamine?
The InChIKey is SSTUKIRKGGVTDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4/c14-9-6-7-12-11(8-9)13(17-16-12)15-10-4-2-1-3-5-10/h1-8H,14H2,(H2,15,16,17).
What are the key properties of 3-N-phenyl-1H-indazole-3,5-diamine?
3-N-phenyl-1H-indazole-3,5-diamine has a molecular weight of 224.27 g/mol, XLogP of 2.89, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-phenyl-1H-indazole-3,5-diamine is sourced from PubChem (CID 89172388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).