C8H15NO — CID 89172437
1-[(2R,5S)-2-ethyl-5-tritiooxolan-3-yl]ethanimine (PubChem CID 89172437) has the molecular formula C8H15NO and a molecular weight of 143.22 g/mol. Its IUPAC name is 1-[(2R,5S)-2-ethyl-5-tritiooxolan-3-yl]ethanimine.
| Compound Name | 1-[(2R,5S)-2-ethyl-5-tritiooxolan-3-yl]ethanimine |
|---|---|
| PubChem CID | 89172437 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 143.22 g/mol |
| Exact Mass | 143.12 |
| IUPAC Name | 1-[(2R,5S)-2-ethyl-5-tritiooxolan-3-yl]ethanimine |
| SMILES | [H]/N=C(\C)C1C[C@H]([3H])O[C@@H]1CC |
| InChI | InChI=1S/C8H15NO/c1-3-8-7(6(2)9)4-5-10-8/h7-9H,3-5H2,1-2H3/b9-6+/t7?,8-/m1/s1/i5T/t5-,7?,8+/m0 |
| InChIKey | ABWNEYHKOYSDTC-KJRJATCESA-N |
| XLogP | 1.84 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|