About 6,7-dihydro-1,6-naphthyridine
6,7-dihydro-1,6-naphthyridine (PubChem CID 89172473) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is 6,7-dihydro-1,6-naphthyridine.
Molecular Properties
| Compound Name | 6,7-dihydro-1,6-naphthyridine |
| PubChem CID | 89172473 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 6,7-dihydro-1,6-naphthyridine |
| SMILES | C1=c2cccnc2=CCN1 |
| InChI | InChI=1S/C8H8N2/c1-2-7-6-9-5-3-8(7)10-4-1/h1-4,6,9H,5H2 |
| InChIKey | MBRUQOOMFDTSDK-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dihydro-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-1,6-naphthyridine?
The IUPAC name of 6,7-dihydro-1,6-naphthyridine (CID 89172473) is 6,7-dihydro-1,6-naphthyridine.
What is the SMILES notation for 6,7-dihydro-1,6-naphthyridine?
The canonical SMILES for 6,7-dihydro-1,6-naphthyridine is C1=c2cccnc2=CCN1.
What is the InChIKey of 6,7-dihydro-1,6-naphthyridine?
The InChIKey is MBRUQOOMFDTSDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2/c1-2-7-6-9-5-3-8(7)10-4-1/h1-4,6,9H,5H2.
What are the key properties of 6,7-dihydro-1,6-naphthyridine?
6,7-dihydro-1,6-naphthyridine has a molecular weight of 132.17 g/mol, XLogP of -0.80, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-1,6-naphthyridine is sourced from PubChem (CID 89172473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).