C22H35NO — CID 89172700
(NE)-N-[7-ethyl-7,9-dimethyl-8-(2-methylcyclopropyl)-3,4,4a,4b,5,6,8,8a,9,10-decahydrophenanthren-2-ylidene]hydroxylamine (PubChem CID 89172700) has the molecular formula C22H35NO and a molecular weight of 329.53 g/mol. Its IUPAC name is (NE)-N-[7-ethyl-7,9-dimethyl-8-(2-methylcyclopropyl)-3,4,4a,4b,5,6,8,8a,9,10-decahydrophenanthren-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[7-ethyl-7,9-dimethyl-8-(2-methylcyclopropyl)-3,4,4a,4b,5,6,8,8a,9,10-decahydrophenanthren-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 89172700 |
| Molecular Formula | C22H35NO |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | (NE)-N-[7-ethyl-7,9-dimethyl-8-(2-methylcyclopropyl)-3,4,4a,4b,5,6,8,8a,9,10-decahydrophenanthren-2-ylidene]hydroxylamine |
| SMILES | CCC1(C)CCC2C3CC/C(=N\O)C=C3CC(C)C2C1C1CC1C |
| InChI | InChI=1S/C22H35NO/c1-5-22(4)9-8-18-17-7-6-16(23-24)12-15(17)10-14(3)20(18)21(22)19-11-13(19)2/h12-14,17-21,24H,5-11H2,1-4H3/b23-16+ |
| InChIKey | WEKTUPULRLQMNG-XQNSMLJCSA-N |
| XLogP | 5.91 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|