About ethyl 1-imino-2,3-dihydroindene-5-carboxylate
ethyl 1-imino-2,3-dihydroindene-5-carboxylate (PubChem CID 89172914) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is ethyl 1-imino-2,3-dihydroindene-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-imino-2,3-dihydroindene-5-carboxylate |
| PubChem CID | 89172914 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | ethyl 1-imino-2,3-dihydroindene-5-carboxylate |
| SMILES | [H]/N=C1\CCc2cc(C(=O)OCC)ccc21 |
| InChI | InChI=1S/C12H13NO2/c1-2-15-12(14)9-3-5-10-8(7-9)4-6-11(10)13/h3,5,7,13H,2,4,6H2,1H3/b13-11+ |
| InChIKey | VSERWWIAUVLONC-ACCUITESSA-N |
| XLogP | 2.18 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-imino-2,3-dihydroindene-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-imino-2,3-dihydroindene-5-carboxylate?
The IUPAC name of ethyl 1-imino-2,3-dihydroindene-5-carboxylate (CID 89172914) is ethyl 1-imino-2,3-dihydroindene-5-carboxylate.
What is the SMILES notation for ethyl 1-imino-2,3-dihydroindene-5-carboxylate?
The canonical SMILES for ethyl 1-imino-2,3-dihydroindene-5-carboxylate is [H]/N=C1\CCc2cc(C(=O)OCC)ccc21.
What is the InChIKey of ethyl 1-imino-2,3-dihydroindene-5-carboxylate?
The InChIKey is VSERWWIAUVLONC-ACCUITESSA-N. The full InChI is InChI=1S/C12H13NO2/c1-2-15-12(14)9-3-5-10-8(7-9)4-6-11(10)13/h3,5,7,13H,2,4,6H2,1H3/b13-11+.
What are the key properties of ethyl 1-imino-2,3-dihydroindene-5-carboxylate?
ethyl 1-imino-2,3-dihydroindene-5-carboxylate has a molecular weight of 203.24 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-imino-2,3-dihydroindene-5-carboxylate is sourced from PubChem (CID 89172914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).