C24H21N5O3 — CID 89172985
methyl 2-[4-[3-[(1-imino-2,3-dihydroinden-5-yl)amino]imidazo[1,2-a]pyrazin-2-yl]phenoxy]acetate (PubChem CID 89172985) has the molecular formula C24H21N5O3 and a molecular weight of 427.46 g/mol. Its IUPAC name is methyl 2-[4-[3-[(1-imino-2,3-dihydroinden-5-yl)amino]imidazo[1,2-a]pyrazin-2-yl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[3-[(1-imino-2,3-dihydroinden-5-yl)amino]imidazo[1,2-a]pyrazin-2-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 89172985 |
| Molecular Formula | C24H21N5O3 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | methyl 2-[4-[3-[(1-imino-2,3-dihydroinden-5-yl)amino]imidazo[1,2-a]pyrazin-2-yl]phenoxy]acetate |
| SMILES | [H]/N=C1\CCc2cc(Nc3c(-c4ccc(OCC(=O)OC)cc4)nc4cnccn34)ccc21 |
| InChI | InChI=1S/C24H21N5O3/c1-31-22(30)14-32-18-6-2-15(3-7-18)23-24(29-11-10-26-13-21(29)28-23)27-17-5-8-19-16(12-17)4-9-20(19)25/h2-3,5-8,10-13,25,27H,4,9,14H2,1H3/b25-20+ |
| InChIKey | HPUMDYOJSUNXLC-LKUDQCMESA-N |
| XLogP | 4.01 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|