C7H3F5O — CID 89173310
2,3,4,5,6-pentafluorocyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 89173310) has the molecular formula C7H3F5O and a molecular weight of 198.09 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluorocyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 2,3,4,5,6-pentafluorocyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 89173310 |
| Molecular Formula | C7H3F5O |
| Molecular Weight | 198.09 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | 2,3,4,5,6-pentafluorocyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | O=CC1C(F)=C(F)C(F)=C(F)C1F |
| InChI | InChI=1S/C7H3F5O/c8-3-2(1-13)4(9)6(11)7(12)5(3)10/h1-3H |
| InChIKey | DPNFXFOPZADZBP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.09 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|