C24H26F22O2 — CID 89173369
[5,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-hexadecafluoro-2-methyl-6,6-bis(trifluoromethyl)tridecyl] 2,3,3-trimethylpentanoate (PubChem CID 89173369) has the molecular formula C24H26F22O2 and a molecular weight of 764.43 g/mol. Its IUPAC name is [5,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-hexadecafluoro-2-methyl-6,6-bis(trifluoromethyl)tridecyl] 2,3,3-trimethylpentanoate.
| Compound Name | [5,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-hexadecafluoro-2-methyl-6,6-bis(trifluoromethyl)tridecyl] 2,3,3-trimethylpentanoate |
|---|---|
| PubChem CID | 89173369 |
| Molecular Formula | C24H26F22O2 |
| Molecular Weight | 764.43 g/mol |
| Exact Mass | 764.16 |
| IUPAC Name | [5,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-hexadecafluoro-2-methyl-6,6-bis(trifluoromethyl)tridecyl] 2,3,3-trimethylpentanoate |
| SMILES | CCC(C)(C)C(C)C(=O)OCC(C)CCC(F)C(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H26F22O2/c1-6-14(4,5)11(3)13(47)48-9-10(2)7-8-12(25)15(22(38,39)40,23(41,42)43)16(26,27)17(28,29)18(30,31)19(32,33)20(34,35)21(36,37)24(44,45)46/h10-12H,6-9H2,1-5H3 |
| InChIKey | CDLUISWGWZVMFY-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.43 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|