C40H26O2S2 — CID 89173484
1-[17-acetyl-2,12-bis[2-(4-methylphenyl)ethynyl]-6,18-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1,3(11),4,7,9,12,14,16,19-nonaen-7-yl]ethanone (PubChem CID 89173484) has the molecular formula C40H26O2S2 and a molecular weight of 602.78 g/mol. Its IUPAC name is 1-[17-acetyl-2,12-bis[2-(4-methylphenyl)ethynyl]-6,18-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1,3(11),4,7,9,12,14,16,19-nonaen-7-yl]ethanone.
| Compound Name | 1-[17-acetyl-2,12-bis[2-(4-methylphenyl)ethynyl]-6,18-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1,3(11),4,7,9,12,14,16,19-nonaen-7-yl]ethanone |
|---|---|
| PubChem CID | 89173484 |
| Molecular Formula | C40H26O2S2 |
| Molecular Weight | 602.78 g/mol |
| Exact Mass | 602.14 |
| IUPAC Name | 1-[17-acetyl-2,12-bis[2-(4-methylphenyl)ethynyl]-6,18-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1,3(11),4,7,9,12,14,16,19-nonaen-7-yl]ethanone |
| SMILES | CC(=O)c1cc2cc3c(C#Cc4ccc(C)cc4)c4cc5cc(C(C)=O)sc5cc4c(C#Cc4ccc(C)cc4)c3cc2s1 |
| InChI | InChI=1S/C40H26O2S2/c1-23-5-9-27(10-6-23)13-15-31-33-17-29-19-37(25(3)41)43-39(29)21-35(33)32(16-14-28-11-7-24(2)8-12-28)36-22-40-30(18-34(31)36)20-38(44-40)26(4)42/h5-12,17-22H,1-4H3 |
| InChIKey | AUNAMZHBWBVKJT-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.78 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|