C8H12N2 — CID 89173610
(2Z,4Z)-1-imino-2-methylhepta-2,4,6-trien-3-amine (PubChem CID 89173610) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is (2Z,4Z)-1-imino-2-methylhepta-2,4,6-trien-3-amine.
| Compound Name | (2Z,4Z)-1-imino-2-methylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 89173610 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (2Z,4Z)-1-imino-2-methylhepta-2,4,6-trien-3-amine |
| SMILES | [H]/N=C/C(C)=C(N)/C=C\C=C |
| InChI | InChI=1S/C8H12N2/c1-3-4-5-8(10)7(2)6-9/h3-6,9H,1,10H2,2H3/b5-4-,8-7-,9-6+ |
| InChIKey | SDVXZLDDEHDWDE-NICTZNNLSA-N |
| XLogP | 1.61 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|