C10H16N2 — CID 89173672
(8E)-8-methyl-4-methylidene-3,5,6,7-tetrahydroazonin-2-amine (PubChem CID 89173672) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (8E)-8-methyl-4-methylidene-3,5,6,7-tetrahydroazonin-2-amine.
| Compound Name | (8E)-8-methyl-4-methylidene-3,5,6,7-tetrahydroazonin-2-amine |
|---|---|
| PubChem CID | 89173672 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (8E)-8-methyl-4-methylidene-3,5,6,7-tetrahydroazonin-2-amine |
| SMILES | C=C1CCC/C(C)=C/N=C(/N)C1 |
| InChI | InChI=1S/C10H16N2/c1-8-4-3-5-9(2)7-12-10(11)6-8/h7H,1,3-6H2,2H3,(H2,11,12)/b9-7+ |
| InChIKey | JQHPZKAGWLCRBC-VQHVLOKHSA-N |
| XLogP | 2.38 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|