C7H8FI — CID 89173675
(1E,3Z,5Z)-1-fluoro-6-iodo-3-methylhexa-1,3,5-triene (PubChem CID 89173675) has the molecular formula C7H8FI and a molecular weight of 238.04 g/mol. Its IUPAC name is (1E,3Z,5Z)-1-fluoro-6-iodo-3-methylhexa-1,3,5-triene.
| Compound Name | (1E,3Z,5Z)-1-fluoro-6-iodo-3-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 89173675 |
| Molecular Formula | C7H8FI |
| Molecular Weight | 238.04 g/mol |
| Exact Mass | 237.97 |
| IUPAC Name | (1E,3Z,5Z)-1-fluoro-6-iodo-3-methylhexa-1,3,5-triene |
| SMILES | CC(=C/C=C\I)/C=C/F |
| InChI | InChI=1S/C7H8FI/c1-7(4-5-8)3-2-6-9/h2-6H,1H3/b5-4+,6-2-,7-3- |
| InChIKey | TYJWIRWHDVVMDF-VOXYVELQSA-N |
| XLogP | 3.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.04 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|