C22H27ClN10O2 — CID 89173728
3,5-diamino-N-[8-[2-[2-[amino(methyl)amino]phenyl]prop-2-enoyl]-1,3,8-triazaspiro[4.5]dec-2-en-2-yl]-6-chloropyrazine-2-carboxamide (PubChem CID 89173728) has the molecular formula C22H27ClN10O2 and a molecular weight of 498.98 g/mol. Its IUPAC name is 3,5-diamino-N-[8-[2-[2-[amino(methyl)amino]phenyl]prop-2-enoyl]-1,3,8-triazaspiro[4.5]dec-2-en-2-yl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[8-[2-[2-[amino(methyl)amino]phenyl]prop-2-enoyl]-1,3,8-triazaspiro[4.5]dec-2-en-2-yl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 89173728 |
| Molecular Formula | C22H27ClN10O2 |
| Molecular Weight | 498.98 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 3,5-diamino-N-[8-[2-[2-[amino(methyl)amino]phenyl]prop-2-enoyl]-1,3,8-triazaspiro[4.5]dec-2-en-2-yl]-6-chloropyrazine-2-carboxamide |
| SMILES | C=C(C(=O)N1CCC2(CC1)CN=C(NC(=O)c1nc(Cl)c(N)nc1N)N2)c1ccccc1N(C)N |
| InChI | InChI=1S/C22H27ClN10O2/c1-12(13-5-3-4-6-14(13)32(2)26)20(35)33-9-7-22(8-10-33)11-27-21(31-22)30-19(34)15-17(24)29-18(25)16(23)28-15/h3-6H,1,7-11,26H2,2H3,(H4,24,25,29)(H2,27,30,31,34) |
| InChIKey | JMGDWPUOKQLKFM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 180.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.98 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|