C24H27BrN2O3 — CID 89173810
(2R,3R)-3-[[(1S)-1-(4-bromophenyl)ethyl]amino]-1-(4-ethynyl-4-phenylpiperidin-1-yl)-2,3-dihydroxypropan-1-one (PubChem CID 89173810) has the molecular formula C24H27BrN2O3 and a molecular weight of 471.40 g/mol. Its IUPAC name is (2R,3R)-3-[[(1S)-1-(4-bromophenyl)ethyl]amino]-1-(4-ethynyl-4-phenylpiperidin-1-yl)-2,3-dihydroxypropan-1-one.
| Compound Name | (2R,3R)-3-[[(1S)-1-(4-bromophenyl)ethyl]amino]-1-(4-ethynyl-4-phenylpiperidin-1-yl)-2,3-dihydroxypropan-1-one |
|---|---|
| PubChem CID | 89173810 |
| Molecular Formula | C24H27BrN2O3 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | (2R,3R)-3-[[(1S)-1-(4-bromophenyl)ethyl]amino]-1-(4-ethynyl-4-phenylpiperidin-1-yl)-2,3-dihydroxypropan-1-one |
| SMILES | C#CC1(c2ccccc2)CCN(C(=O)[C@H](O)[C@@H](O)N[C@@H](C)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C24H27BrN2O3/c1-3-24(19-7-5-4-6-8-19)13-15-27(16-14-24)23(30)21(28)22(29)26-17(2)18-9-11-20(25)12-10-18/h1,4-12,17,21-22,26,28-29H,13-16H2,2H3/t17-,21+,22+/m0/s1 |
| InChIKey | WZOIRQSDEDCTJQ-MTNREXPMSA-N |
| XLogP | 2.97 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|