C18H31NO — CID 89174567
N-[(5Z)-6,10-dimethylundeca-5,9-dien-4-ylidene]-2,2-dimethylpropanamide (PubChem CID 89174567) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is N-[(5Z)-6,10-dimethylundeca-5,9-dien-4-ylidene]-2,2-dimethylpropanamide.
| Compound Name | N-[(5Z)-6,10-dimethylundeca-5,9-dien-4-ylidene]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 89174567 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | N-[(5Z)-6,10-dimethylundeca-5,9-dien-4-ylidene]-2,2-dimethylpropanamide |
| SMILES | CCCC(/C=C(/C)CCC=C(C)C)=N\C(=O)C(C)(C)C |
| InChI | InChI=1S/C18H31NO/c1-8-10-16(19-17(20)18(5,6)7)13-15(4)12-9-11-14(2)3/h11,13H,8-10,12H2,1-7H3/b15-13-,19-16+ |
| InChIKey | QJENXZSGQVWTBD-KIITWETNSA-N |
| XLogP | 5.49 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|