About N-[2-(4-amino-1,3-dioxoisoindol-2-yl)acetyl]-2-hydroxybutanamide
N-[2-(4-amino-1,3-dioxoisoindol-2-yl)acetyl]-2-hydroxybutanamide (PubChem CID 89174603) has the molecular formula C14H15N3O5
and a molecular weight of 305.29 g/mol. Its IUPAC name is N-[2-(4-amino-1,3-dioxoisoindol-2-yl)acetyl]-2-hydroxybutanamide.
Molecular Properties
| Compound Name | N-[2-(4-amino-1,3-dioxoisoindol-2-yl)acetyl]-2-hydroxybutanamide |
| PubChem CID | 89174603 |
| Molecular Formula | C14H15N3O5 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-[2-(4-amino-1,3-dioxoisoindol-2-yl)acetyl]-2-hydroxybutanamide |
| SMILES | CCC(O)C(=O)NC(=O)CN1C(=O)c2cccc(N)c2C1=O |
| InChI | InChI=1S/C14H15N3O5/c1-2-9(18)12(20)16-10(19)6-17-13(21)7-4-3-5-8(15)11(7)14(17)22/h3-5,9,18H,2,6,15H2,1H3,(H,16,19,20) |
| InChIKey | KGIWHYRTQGRTDK-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(4-amino-1,3-dioxoisoindol-2-yl)acetyl]-2-hydroxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-amino-1,3-dioxoisoindol-2-yl)acetyl]-2-hydroxybutanamide?
The IUPAC name of N-[2-(4-amino-1,3-dioxoisoindol-2-yl)acetyl]-2-hydroxybutanamide (CID 89174603) is N-[2-(4-amino-1,3-dioxoisoindol-2-yl)acetyl]-2-hydroxybutanamide.
What is the SMILES notation for N-[2-(4-amino-1,3-dioxoisoindol-2-yl)acetyl]-2-hydroxybutanamide?
The canonical SMILES for N-[2-(4-amino-1,3-dioxoisoindol-2-yl)acetyl]-2-hydroxybutanamide is CCC(O)C(=O)NC(=O)CN1C(=O)c2cccc(N)c2C1=O.
What is the InChIKey of N-[2-(4-amino-1,3-dioxoisoindol-2-yl)acetyl]-2-hydroxybutanamide?
The InChIKey is KGIWHYRTQGRTDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O5/c1-2-9(18)12(20)16-10(19)6-17-13(21)7-4-3-5-8(15)11(7)14(17)22/h3-5,9,18H,2,6,15H2,1H3,(H,16,19,20).
What are the key properties of N-[2-(4-amino-1,3-dioxoisoindol-2-yl)acetyl]-2-hydroxybutanamide?
N-[2-(4-amino-1,3-dioxoisoindol-2-yl)acetyl]-2-hydroxybutanamide has a molecular weight of 305.29 g/mol, XLogP of -0.72, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-amino-1,3-dioxoisoindol-2-yl)acetyl]-2-hydroxybutanamide is sourced from PubChem (CID 89174603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).