C25H19ClF4N2S — CID 89174648
N-[1-[6-(4-chloro-2-fluorophenyl)benzo[b][1,4]benzothiazepin-3-yl]ethenyl]-4,4,4-trifluorobutan-1-amine (PubChem CID 89174648) has the molecular formula C25H19ClF4N2S and a molecular weight of 490.95 g/mol. Its IUPAC name is N-[1-[6-(4-chloro-2-fluorophenyl)benzo[b][1,4]benzothiazepin-3-yl]ethenyl]-4,4,4-trifluorobutan-1-amine.
| Compound Name | N-[1-[6-(4-chloro-2-fluorophenyl)benzo[b][1,4]benzothiazepin-3-yl]ethenyl]-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 89174648 |
| Molecular Formula | C25H19ClF4N2S |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | N-[1-[6-(4-chloro-2-fluorophenyl)benzo[b][1,4]benzothiazepin-3-yl]ethenyl]-4,4,4-trifluorobutan-1-amine |
| SMILES | C=C(NCCCC(F)(F)F)c1ccc2c(c1)N=C(c1ccc(Cl)cc1F)c1ccccc1S2 |
| InChI | InChI=1S/C25H19ClF4N2S/c1-15(31-12-4-11-25(28,29)30)16-7-10-23-21(13-16)32-24(18-9-8-17(26)14-20(18)27)19-5-2-3-6-22(19)33-23/h2-3,5-10,13-14,31H,1,4,11-12H2 |
| InChIKey | BBZJTNVKIAWRLL-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|