C24H29N — CID 89174666
(2Z,4E,5Z,8Z)-3-methyl-7-methylidene-4-[(2Z)-2-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethylidene]-6-prop-1-en-2-yldeca-2,5,8-trien-1-amine (PubChem CID 89174666) has the molecular formula C24H29N and a molecular weight of 331.50 g/mol. Its IUPAC name is (2Z,4E,5Z,8Z)-3-methyl-7-methylidene-4-[(2Z)-2-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethylidene]-6-prop-1-en-2-yldeca-2,5,8-trien-1-amine.
| Compound Name | (2Z,4E,5Z,8Z)-3-methyl-7-methylidene-4-[(2Z)-2-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethylidene]-6-prop-1-en-2-yldeca-2,5,8-trien-1-amine |
|---|---|
| PubChem CID | 89174666 |
| Molecular Formula | C24H29N |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | (2Z,4E,5Z,8Z)-3-methyl-7-methylidene-4-[(2Z)-2-(6-methylidenecyclohexa-2,4-dien-1-ylidene)ethylidene]-6-prop-1-en-2-yldeca-2,5,8-trien-1-amine |
| SMILES | C=C(C)C(=CC(=C\C=c1\ccccc1=C)/C(C)=C\CN)C(=C)/C=C\C |
| InChI | InChI=1S/C24H29N/c1-7-10-21(6)24(18(2)3)17-23(20(5)15-16-25)14-13-22-12-9-8-11-19(22)4/h7-15,17H,2,4,6,16,25H2,1,3,5H3/b10-7-,20-15-,22-13-,23-14+,24-17- |
| InChIKey | NZDBXEJNLHFUBJ-DRUSELLDSA-N |
| XLogP | 4.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|