C9H12O2 — CID 89174842
4-hydroxy-2,3,3a,4,5,6-hexahydroinden-1-one (PubChem CID 89174842) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 4-hydroxy-2,3,3a,4,5,6-hexahydroinden-1-one.
| Compound Name | 4-hydroxy-2,3,3a,4,5,6-hexahydroinden-1-one |
|---|---|
| PubChem CID | 89174842 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 4-hydroxy-2,3,3a,4,5,6-hexahydroinden-1-one |
| SMILES | O=C1CCC2C1=CCCC2O |
| InChI | InChI=1S/C9H12O2/c10-8-3-1-2-6-7(8)4-5-9(6)11/h2,7-8,10H,1,3-5H2 |
| InChIKey | XPWRSVVBNNHZML-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |