C22H17F3N4O4 — CID 89174896
2-[7-[5-[3-amino-5-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl]acetic acid (PubChem CID 89174896) has the molecular formula C22H17F3N4O4 and a molecular weight of 458.40 g/mol. Its IUPAC name is 2-[7-[5-[3-amino-5-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl]acetic acid.
| Compound Name | 2-[7-[5-[3-amino-5-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 89174896 |
| Molecular Formula | C22H17F3N4O4 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 2-[7-[5-[3-amino-5-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl]acetic acid |
| SMILES | Nc1cc(OC(F)(F)F)cc(-c2nc(-c3ccc4[nH]c5c(c4c3)CCC5CC(=O)O)no2)c1 |
| InChI | InChI=1S/C22H17F3N4O4/c23-22(24,25)32-14-6-12(5-13(26)9-14)21-28-20(29-33-21)11-2-4-17-16(7-11)15-3-1-10(8-18(30)31)19(15)27-17/h2,4-7,9-10,27H,1,3,8,26H2,(H,30,31) |
| InChIKey | YIAYCYJACCZHLS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 127.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|