C16H16ClN3O — CID 891749
5-(azepan-1-yl)-2-(4-chlorophenyl)-1,3-oxazole-4-carbonitrile (PubChem CID 891749) has the molecular formula C16H16ClN3O and a molecular weight of 301.78 g/mol. Its IUPAC name is 5-(azepan-1-yl)-2-(4-chlorophenyl)-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-(azepan-1-yl)-2-(4-chlorophenyl)-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 891749 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 5-(azepan-1-yl)-2-(4-chlorophenyl)-1,3-oxazole-4-carbonitrile |
| SMILES | N#Cc1nc(-c2ccc(Cl)cc2)oc1N1CCCCCC1 |
| InChI | InChI=1S/C16H16ClN3O/c17-13-7-5-12(6-8-13)15-19-14(11-18)16(21-15)20-9-3-1-2-4-10-20/h5-8H,1-4,9-10H2 |
| InChIKey | UOTXZJMLDWKBAC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 53.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |