About ethyl 2-ethyl-2,3-dihydrothiophene-4-carboxylate
ethyl 2-ethyl-2,3-dihydrothiophene-4-carboxylate (PubChem CID 89174964) has the molecular formula C9H14O2S
and a molecular weight of 186.28 g/mol. Its IUPAC name is ethyl 2-ethyl-2,3-dihydrothiophene-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-ethyl-2,3-dihydrothiophene-4-carboxylate |
| PubChem CID | 89174964 |
| Molecular Formula | C9H14O2S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | ethyl 2-ethyl-2,3-dihydrothiophene-4-carboxylate |
| SMILES | CCOC(=O)C1=CSC(CC)C1 |
| InChI | InChI=1S/C9H14O2S/c1-3-8-5-7(6-12-8)9(10)11-4-2/h6,8H,3-5H2,1-2H3 |
| InChIKey | YUKLGNKVIKRKES-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-ethyl-2,3-dihydrothiophene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-ethyl-2,3-dihydrothiophene-4-carboxylate?
The IUPAC name of ethyl 2-ethyl-2,3-dihydrothiophene-4-carboxylate (CID 89174964) is ethyl 2-ethyl-2,3-dihydrothiophene-4-carboxylate.
What is the SMILES notation for ethyl 2-ethyl-2,3-dihydrothiophene-4-carboxylate?
The canonical SMILES for ethyl 2-ethyl-2,3-dihydrothiophene-4-carboxylate is CCOC(=O)C1=CSC(CC)C1.
What is the InChIKey of ethyl 2-ethyl-2,3-dihydrothiophene-4-carboxylate?
The InChIKey is YUKLGNKVIKRKES-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2S/c1-3-8-5-7(6-12-8)9(10)11-4-2/h6,8H,3-5H2,1-2H3.
What are the key properties of ethyl 2-ethyl-2,3-dihydrothiophene-4-carboxylate?
ethyl 2-ethyl-2,3-dihydrothiophene-4-carboxylate has a molecular weight of 186.28 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-ethyl-2,3-dihydrothiophene-4-carboxylate is sourced from PubChem (CID 89174964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).