About (1R)-1-[(1R)-2-butan-2-ylcyclopenta-2,4-dien-1-yl]-N,N-dimethylethanamine
(1R)-1-[(1R)-2-butan-2-ylcyclopenta-2,4-dien-1-yl]-N,N-dimethylethanamine (PubChem CID 89175118) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is (1R)-1-[(1R)-2-butan-2-ylcyclopenta-2,4-dien-1-yl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | (1R)-1-[(1R)-2-butan-2-ylcyclopenta-2,4-dien-1-yl]-N,N-dimethylethanamine |
| PubChem CID | 89175118 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (1R)-1-[(1R)-2-butan-2-ylcyclopenta-2,4-dien-1-yl]-N,N-dimethylethanamine |
| SMILES | CCC(C)C1=CC=C[C@H]1[C@@H](C)N(C)C |
| InChI | InChI=1S/C13H23N/c1-6-10(2)12-8-7-9-13(12)11(3)14(4)5/h7-11,13H,6H2,1-5H3/t10?,11-,13+/m1/s1 |
| InChIKey | NRBAHNDQDFQTDV-ZNVNOEFISA-N |
| XLogP | 3.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-1-[(1R)-2-butan-2-ylcyclopenta-2,4-dien-1-yl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[(1R)-2-butan-2-ylcyclopenta-2,4-dien-1-yl]-N,N-dimethylethanamine?
The IUPAC name of (1R)-1-[(1R)-2-butan-2-ylcyclopenta-2,4-dien-1-yl]-N,N-dimethylethanamine (CID 89175118) is (1R)-1-[(1R)-2-butan-2-ylcyclopenta-2,4-dien-1-yl]-N,N-dimethylethanamine.
What is the SMILES notation for (1R)-1-[(1R)-2-butan-2-ylcyclopenta-2,4-dien-1-yl]-N,N-dimethylethanamine?
The canonical SMILES for (1R)-1-[(1R)-2-butan-2-ylcyclopenta-2,4-dien-1-yl]-N,N-dimethylethanamine is CCC(C)C1=CC=C[C@H]1[C@@H](C)N(C)C.
What is the InChIKey of (1R)-1-[(1R)-2-butan-2-ylcyclopenta-2,4-dien-1-yl]-N,N-dimethylethanamine?
The InChIKey is NRBAHNDQDFQTDV-ZNVNOEFISA-N. The full InChI is InChI=1S/C13H23N/c1-6-10(2)12-8-7-9-13(12)11(3)14(4)5/h7-11,13H,6H2,1-5H3/t10?,11-,13+/m1/s1.
What are the key properties of (1R)-1-[(1R)-2-butan-2-ylcyclopenta-2,4-dien-1-yl]-N,N-dimethylethanamine?
(1R)-1-[(1R)-2-butan-2-ylcyclopenta-2,4-dien-1-yl]-N,N-dimethylethanamine has a molecular weight of 193.33 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[(1R)-2-butan-2-ylcyclopenta-2,4-dien-1-yl]-N,N-dimethylethanamine is sourced from PubChem (CID 89175118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).