C16H18N4O2 — CID 89175244
4-amino-3-carbamimidoyl-N-[(3-methoxyphenyl)methyl]benzamide (PubChem CID 89175244) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 4-amino-3-carbamimidoyl-N-[(3-methoxyphenyl)methyl]benzamide.
| Compound Name | 4-amino-3-carbamimidoyl-N-[(3-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 89175244 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 4-amino-3-carbamimidoyl-N-[(3-methoxyphenyl)methyl]benzamide |
| SMILES | [H]/N=C(\N)c1cc(C(=O)NCc2cccc(OC)c2)ccc1N |
| InChI | InChI=1S/C16H18N4O2/c1-22-12-4-2-3-10(7-12)9-20-16(21)11-5-6-14(17)13(8-11)15(18)19/h2-8H,9,17H2,1H3,(H3,18,19)(H,20,21) |
| InChIKey | JGKKBDNEWOJMCX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 114.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|