C12H22O3 — CID 89175590
(2S,3S,4R)-4-methoxy-2,4,6-trimethyl-3-prop-2-enoxyoxane (PubChem CID 89175590) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (2S,3S,4R)-4-methoxy-2,4,6-trimethyl-3-prop-2-enoxyoxane.
| Compound Name | (2S,3S,4R)-4-methoxy-2,4,6-trimethyl-3-prop-2-enoxyoxane |
|---|---|
| PubChem CID | 89175590 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (2S,3S,4R)-4-methoxy-2,4,6-trimethyl-3-prop-2-enoxyoxane |
| SMILES | C=CCO[C@H]1[C@H](C)OC(C)C[C@@]1(C)OC |
| InChI | InChI=1S/C12H22O3/c1-6-7-14-11-10(3)15-9(2)8-12(11,4)13-5/h6,9-11H,1,7-8H2,2-5H3/t9?,10-,11-,12+/m0/s1 |
| InChIKey | UGRLACQPGCGMSP-HSTDOPHLSA-N |
| XLogP | 2.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|