C12H19I — CID 89175619
1-iodo-6,7-dimethyl-1,2,3,4,5,6,7,8-octahydronaphthalene (PubChem CID 89175619) has the molecular formula C12H19I and a molecular weight of 290.19 g/mol. Its IUPAC name is 1-iodo-6,7-dimethyl-1,2,3,4,5,6,7,8-octahydronaphthalene.
| Compound Name | 1-iodo-6,7-dimethyl-1,2,3,4,5,6,7,8-octahydronaphthalene |
|---|---|
| PubChem CID | 89175619 |
| Molecular Formula | C12H19I |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 1-iodo-6,7-dimethyl-1,2,3,4,5,6,7,8-octahydronaphthalene |
| SMILES | CC1CC2=C(CC1C)C(I)CCC2 |
| InChI | InChI=1S/C12H19I/c1-8-6-10-4-3-5-12(13)11(10)7-9(8)2/h8-9,12H,3-7H2,1-2H3 |
| InChIKey | IDOXFYOGVOYXBA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|