About N-octan-2-yl-N-(2,2,2-trifluoroethyl)prop-2-enamide
N-octan-2-yl-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 89175763) has the molecular formula C13H22F3NO
and a molecular weight of 265.32 g/mol. Its IUPAC name is N-octan-2-yl-N-(2,2,2-trifluoroethyl)prop-2-enamide.
Molecular Properties
| Compound Name | N-octan-2-yl-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| PubChem CID | 89175763 |
| Molecular Formula | C13H22F3NO |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | N-octan-2-yl-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | C=CC(=O)N(CC(F)(F)F)C(C)CCCCCC |
| InChI | InChI=1S/C13H22F3NO/c1-4-6-7-8-9-11(3)17(12(18)5-2)10-13(14,15)16/h5,11H,2,4,6-10H2,1,3H3 |
| InChIKey | QPNZVSGHFTYLQZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-octan-2-yl-N-(2,2,2-trifluoroethyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-octan-2-yl-N-(2,2,2-trifluoroethyl)prop-2-enamide?
The IUPAC name of N-octan-2-yl-N-(2,2,2-trifluoroethyl)prop-2-enamide (CID 89175763) is N-octan-2-yl-N-(2,2,2-trifluoroethyl)prop-2-enamide.
What is the SMILES notation for N-octan-2-yl-N-(2,2,2-trifluoroethyl)prop-2-enamide?
The canonical SMILES for N-octan-2-yl-N-(2,2,2-trifluoroethyl)prop-2-enamide is C=CC(=O)N(CC(F)(F)F)C(C)CCCCCC.
What is the InChIKey of N-octan-2-yl-N-(2,2,2-trifluoroethyl)prop-2-enamide?
The InChIKey is QPNZVSGHFTYLQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22F3NO/c1-4-6-7-8-9-11(3)17(12(18)5-2)10-13(14,15)16/h5,11H,2,4,6-10H2,1,3H3.
What are the key properties of N-octan-2-yl-N-(2,2,2-trifluoroethyl)prop-2-enamide?
N-octan-2-yl-N-(2,2,2-trifluoroethyl)prop-2-enamide has a molecular weight of 265.32 g/mol, XLogP of 3.92, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-octan-2-yl-N-(2,2,2-trifluoroethyl)prop-2-enamide is sourced from PubChem (CID 89175763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).