C17H24F6O4 — CID 89176026
[8,8,8-trifluoro-7-hydroxy-7-(trifluoromethyl)octyl] 1-hydroxybicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 89176026) has the molecular formula C17H24F6O4 and a molecular weight of 406.36 g/mol. Its IUPAC name is [8,8,8-trifluoro-7-hydroxy-7-(trifluoromethyl)octyl] 1-hydroxybicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | [8,8,8-trifluoro-7-hydroxy-7-(trifluoromethyl)octyl] 1-hydroxybicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 89176026 |
| Molecular Formula | C17H24F6O4 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | [8,8,8-trifluoro-7-hydroxy-7-(trifluoromethyl)octyl] 1-hydroxybicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | O=C(OCCCCCCC(O)(C(F)(F)F)C(F)(F)F)C1CC2CCC1(O)C2 |
| InChI | InChI=1S/C17H24F6O4/c18-16(19,20)15(26,17(21,22)23)6-3-1-2-4-8-27-13(24)12-9-11-5-7-14(12,25)10-11/h11-12,25-26H,1-10H2 |
| InChIKey | ZREIAWKVABYFIX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|