About N'-chloro-2,2-diethoxyethanimidamide
N'-chloro-2,2-diethoxyethanimidamide (PubChem CID 89176144) has the molecular formula C6H13ClN2O2
and a molecular weight of 180.63 g/mol. Its IUPAC name is N'-chloro-2,2-diethoxyethanimidamide.
Molecular Properties
| Compound Name | N'-chloro-2,2-diethoxyethanimidamide |
| PubChem CID | 89176144 |
| Molecular Formula | C6H13ClN2O2 |
| Molecular Weight | 180.63 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | N'-chloro-2,2-diethoxyethanimidamide |
| SMILES | CCOC(OCC)/C(N)=N/Cl |
| InChI | InChI=1S/C6H13ClN2O2/c1-3-10-6(11-4-2)5(8)9-7/h6H,3-4H2,1-2H3,(H2,8,9) |
| InChIKey | SPQMAHCXHPLIOQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.63 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-chloro-2,2-diethoxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-chloro-2,2-diethoxyethanimidamide?
The IUPAC name of N'-chloro-2,2-diethoxyethanimidamide (CID 89176144) is N'-chloro-2,2-diethoxyethanimidamide.
What is the SMILES notation for N'-chloro-2,2-diethoxyethanimidamide?
The canonical SMILES for N'-chloro-2,2-diethoxyethanimidamide is CCOC(OCC)/C(N)=N/Cl.
What is the InChIKey of N'-chloro-2,2-diethoxyethanimidamide?
The InChIKey is SPQMAHCXHPLIOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13ClN2O2/c1-3-10-6(11-4-2)5(8)9-7/h6H,3-4H2,1-2H3,(H2,8,9).
What are the key properties of N'-chloro-2,2-diethoxyethanimidamide?
N'-chloro-2,2-diethoxyethanimidamide has a molecular weight of 180.63 g/mol, XLogP of 0.90, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-chloro-2,2-diethoxyethanimidamide is sourced from PubChem (CID 89176144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).