C23H26NO4+ — CID 89176254
16,17-dimethoxy-21-propyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,13,15(20),16,18-heptaene (PubChem CID 89176254) has the molecular formula C23H26NO4+ and a molecular weight of 380.46 g/mol. Its IUPAC name is 16,17-dimethoxy-21-propyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,13,15(20),16,18-heptaene.
| Compound Name | 16,17-dimethoxy-21-propyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,13,15(20),16,18-heptaene |
|---|---|
| PubChem CID | 89176254 |
| Molecular Formula | C23H26NO4+ |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 16,17-dimethoxy-21-propyl-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,13,15(20),16,18-heptaene |
| SMILES | CCCC1c2ccc(OC)c(OC)c2C=[N+]2CCc3cc4c(cc3C12)OCO4 |
| InChI | InChI=1S/C23H26NO4/c1-4-5-16-15-6-7-19(25-2)23(26-3)18(15)12-24-9-8-14-10-20-21(28-13-27-20)11-17(14)22(16)24/h6-7,10-12,16,22H,4-5,8-9,13H2,1-3H3/q+1 |
| InChIKey | BLOVOYYZRDCUMR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 39.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|