About (R)-2-hydroxyethyl-prop-2-enoyl-prop-2-enyl-(2,2,2-trifluoroethyl)azanium
(R)-2-hydroxyethyl-prop-2-enoyl-prop-2-enyl-(2,2,2-trifluoroethyl)azanium (PubChem CID 89176264) has the molecular formula C10H15F3NO2+
and a molecular weight of 238.23 g/mol. Its IUPAC name is (R)-2-hydroxyethyl-prop-2-enoyl-prop-2-enyl-(2,2,2-trifluoroethyl)azanium.
Molecular Properties
| Compound Name | (R)-2-hydroxyethyl-prop-2-enoyl-prop-2-enyl-(2,2,2-trifluoroethyl)azanium |
| PubChem CID | 89176264 |
| Molecular Formula | C10H15F3NO2+ |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (R)-2-hydroxyethyl-prop-2-enoyl-prop-2-enyl-(2,2,2-trifluoroethyl)azanium |
| SMILES | C=CC[N@@+](CCO)(CC(F)(F)F)C(=O)C=C |
| InChI | InChI=1S/C10H15F3NO2/c1-3-5-14(6-7-15,9(16)4-2)8-10(11,12)13/h3-4,15H,1-2,5-8H2/q+1/t14-/m1/s1 |
| InChIKey | YIODMFSEUFZCJJ-CQSZACIVSA-N |
| XLogP | 1.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (R)-2-hydroxyethyl-prop-2-enoyl-prop-2-enyl-(2,2,2-trifluoroethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-2-hydroxyethyl-prop-2-enoyl-prop-2-enyl-(2,2,2-trifluoroethyl)azanium?
The IUPAC name of (R)-2-hydroxyethyl-prop-2-enoyl-prop-2-enyl-(2,2,2-trifluoroethyl)azanium (CID 89176264) is (R)-2-hydroxyethyl-prop-2-enoyl-prop-2-enyl-(2,2,2-trifluoroethyl)azanium.
What is the SMILES notation for (R)-2-hydroxyethyl-prop-2-enoyl-prop-2-enyl-(2,2,2-trifluoroethyl)azanium?
The canonical SMILES for (R)-2-hydroxyethyl-prop-2-enoyl-prop-2-enyl-(2,2,2-trifluoroethyl)azanium is C=CC[N@@+](CCO)(CC(F)(F)F)C(=O)C=C.
What is the InChIKey of (R)-2-hydroxyethyl-prop-2-enoyl-prop-2-enyl-(2,2,2-trifluoroethyl)azanium?
The InChIKey is YIODMFSEUFZCJJ-CQSZACIVSA-N. The full InChI is InChI=1S/C10H15F3NO2/c1-3-5-14(6-7-15,9(16)4-2)8-10(11,12)13/h3-4,15H,1-2,5-8H2/q+1/t14-/m1/s1.
What are the key properties of (R)-2-hydroxyethyl-prop-2-enoyl-prop-2-enyl-(2,2,2-trifluoroethyl)azanium?
(R)-2-hydroxyethyl-prop-2-enoyl-prop-2-enyl-(2,2,2-trifluoroethyl)azanium has a molecular weight of 238.23 g/mol, XLogP of 1.26, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-2-hydroxyethyl-prop-2-enoyl-prop-2-enyl-(2,2,2-trifluoroethyl)azanium is sourced from PubChem (CID 89176264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).