C24H25N7 — CID 89176610
N-[(E)-(3-methylphenyl)methylideneamino]-2-phenyl-7-piperazin-1-ylpyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 89176610) has the molecular formula C24H25N7 and a molecular weight of 411.51 g/mol. Its IUPAC name is N-[(E)-(3-methylphenyl)methylideneamino]-2-phenyl-7-piperazin-1-ylpyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | N-[(E)-(3-methylphenyl)methylideneamino]-2-phenyl-7-piperazin-1-ylpyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 89176610 |
| Molecular Formula | C24H25N7 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | N-[(E)-(3-methylphenyl)methylideneamino]-2-phenyl-7-piperazin-1-ylpyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | Cc1cccc(/C=N/Nc2cc(N3CCNCC3)n3nc(-c4ccccc4)cc3n2)c1 |
| InChI | InChI=1S/C24H25N7/c1-18-6-5-7-19(14-18)17-26-28-22-16-24(30-12-10-25-11-13-30)31-23(27-22)15-21(29-31)20-8-3-2-4-9-20/h2-9,14-17,25H,10-13H2,1H3,(H,27,28)/b26-17+ |
| InChIKey | DFOZAEAYLDXTLD-YZSQISJMSA-N |
| XLogP | 3.56 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|