C11H15N — CID 89176803
2-ethyl-3,4,7,8-tetrahydroquinoline (PubChem CID 89176803) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 2-ethyl-3,4,7,8-tetrahydroquinoline.
| Compound Name | 2-ethyl-3,4,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 89176803 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 2-ethyl-3,4,7,8-tetrahydroquinoline |
| SMILES | CCC1=NC2=C(C=CCC2)CC1 |
| InChI | InChI=1S/C11H15N/c1-2-10-8-7-9-5-3-4-6-11(9)12-10/h3,5H,2,4,6-8H2,1H3 |
| InChIKey | LNOZXXUFAINZAR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |