C26H25I — CID 89176835
(9aS)-7-[2-[(1Z)-buta-1,3-dienyl]-4-iodo-3-methylphenyl]-9,9-dimethyl-4a,9a-dihydrofluorene (PubChem CID 89176835) has the molecular formula C26H25I and a molecular weight of 464.39 g/mol. Its IUPAC name is (9aS)-7-[2-[(1Z)-buta-1,3-dienyl]-4-iodo-3-methylphenyl]-9,9-dimethyl-4a,9a-dihydrofluorene.
| Compound Name | (9aS)-7-[2-[(1Z)-buta-1,3-dienyl]-4-iodo-3-methylphenyl]-9,9-dimethyl-4a,9a-dihydrofluorene |
|---|---|
| PubChem CID | 89176835 |
| Molecular Formula | C26H25I |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | (9aS)-7-[2-[(1Z)-buta-1,3-dienyl]-4-iodo-3-methylphenyl]-9,9-dimethyl-4a,9a-dihydrofluorene |
| SMILES | C=C/C=C\c1c(-c2ccc3c(c2)C(C)(C)[C@H]2C=CC=CC32)ccc(I)c1C |
| InChI | InChI=1S/C26H25I/c1-5-6-9-19-17(2)25(27)15-14-20(19)18-12-13-22-21-10-7-8-11-23(21)26(3,4)24(22)16-18/h5-16,21,23H,1H2,2-4H3/b9-6-/t21?,23-/m0/s1 |
| InChIKey | WFXGAFMXJWPYCQ-KGXVUQKGSA-N |
| XLogP | 7.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|