About (3Z,5E)-5-iodo-3-methylocta-3,5-diene
(3Z,5E)-5-iodo-3-methylocta-3,5-diene (PubChem CID 89176925) has the molecular formula C9H15I
and a molecular weight of 250.12 g/mol. Its IUPAC name is (3Z,5E)-5-iodo-3-methylocta-3,5-diene.
Molecular Properties
| Compound Name | (3Z,5E)-5-iodo-3-methylocta-3,5-diene |
| PubChem CID | 89176925 |
| Molecular Formula | C9H15I |
| Molecular Weight | 250.12 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | (3Z,5E)-5-iodo-3-methylocta-3,5-diene |
| SMILES | CC/C=C(I)\C=C(\C)CC |
| InChI | InChI=1S/C9H15I/c1-4-6-9(10)7-8(3)5-2/h6-7H,4-5H2,1-3H3/b8-7-,9-6+ |
| InChIKey | GXFUYYUXSRDGMT-SOKJVCRVSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.12 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5E)-5-iodo-3-methylocta-3,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5E)-5-iodo-3-methylocta-3,5-diene?
The IUPAC name of (3Z,5E)-5-iodo-3-methylocta-3,5-diene (CID 89176925) is (3Z,5E)-5-iodo-3-methylocta-3,5-diene.
What is the SMILES notation for (3Z,5E)-5-iodo-3-methylocta-3,5-diene?
The canonical SMILES for (3Z,5E)-5-iodo-3-methylocta-3,5-diene is CC/C=C(I)\C=C(\C)CC.
What is the InChIKey of (3Z,5E)-5-iodo-3-methylocta-3,5-diene?
The InChIKey is GXFUYYUXSRDGMT-SOKJVCRVSA-N. The full InChI is InChI=1S/C9H15I/c1-4-6-9(10)7-8(3)5-2/h6-7H,4-5H2,1-3H3/b8-7-,9-6+.
What are the key properties of (3Z,5E)-5-iodo-3-methylocta-3,5-diene?
(3Z,5E)-5-iodo-3-methylocta-3,5-diene has a molecular weight of 250.12 g/mol, XLogP of 4.07, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5E)-5-iodo-3-methylocta-3,5-diene is sourced from PubChem (CID 89176925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).