C22H21I — CID 89176944
2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-7-iodo-9,9-dimethylfluorene (PubChem CID 89176944) has the molecular formula C22H21I and a molecular weight of 412.31 g/mol. Its IUPAC name is 2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-7-iodo-9,9-dimethylfluorene.
| Compound Name | 2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-7-iodo-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 89176944 |
| Molecular Formula | C22H21I |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-7-iodo-9,9-dimethylfluorene |
| SMILES | C=C/C(=C\C=C/C)c1ccc2c(c1)C(C)(C)c1cc(I)ccc1-2 |
| InChI | InChI=1S/C22H21I/c1-5-7-8-15(6-2)16-9-11-18-19-12-10-17(23)14-21(19)22(3,4)20(18)13-16/h5-14H,2H2,1,3-4H3/b7-5-,15-8+ |
| InChIKey | VJSCVPMNSNQZEF-VEQUYXNOSA-N |
| XLogP | 6.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|