C32H50N2 — CID 89177017
1-[2-(3,3-dimethyl-5-methylidenecyclohexyl)-4-(3,3,5,5-tetramethylcyclohexen-1-yl)phenyl]-4-propylpiperazine (PubChem CID 89177017) has the molecular formula C32H50N2 and a molecular weight of 462.77 g/mol. Its IUPAC name is 1-[2-(3,3-dimethyl-5-methylidenecyclohexyl)-4-(3,3,5,5-tetramethylcyclohexen-1-yl)phenyl]-4-propylpiperazine.
| Compound Name | 1-[2-(3,3-dimethyl-5-methylidenecyclohexyl)-4-(3,3,5,5-tetramethylcyclohexen-1-yl)phenyl]-4-propylpiperazine |
|---|---|
| PubChem CID | 89177017 |
| Molecular Formula | C32H50N2 |
| Molecular Weight | 462.77 g/mol |
| Exact Mass | 462.40 |
| IUPAC Name | 1-[2-(3,3-dimethyl-5-methylidenecyclohexyl)-4-(3,3,5,5-tetramethylcyclohexen-1-yl)phenyl]-4-propylpiperazine |
| SMILES | C=C1CC(c2cc(C3=CC(C)(C)CC(C)(C)C3)ccc2N2CCN(CCC)CC2)CC(C)(C)C1 |
| InChI | InChI=1S/C32H50N2/c1-9-12-33-13-15-34(16-14-33)29-11-10-25(27-21-31(5,6)23-32(7,8)22-27)18-28(29)26-17-24(2)19-30(3,4)20-26/h10-11,18,21,26H,2,9,12-17,19-20,22-23H2,1,3-8H3 |
| InChIKey | UIKOBBRDJWQNQF-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.77 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|