C26H23I — CID 89177070
7-[(E,1E)-1-(4-iodocyclohexa-2,4-dien-1-ylidene)pent-2-en-4-yn-2-yl]-9,9-dimethyl-3,4-dihydrofluorene (PubChem CID 89177070) has the molecular formula C26H23I and a molecular weight of 462.37 g/mol. Its IUPAC name is 7-[(E,1E)-1-(4-iodocyclohexa-2,4-dien-1-ylidene)pent-2-en-4-yn-2-yl]-9,9-dimethyl-3,4-dihydrofluorene.
| Compound Name | 7-[(E,1E)-1-(4-iodocyclohexa-2,4-dien-1-ylidene)pent-2-en-4-yn-2-yl]-9,9-dimethyl-3,4-dihydrofluorene |
|---|---|
| PubChem CID | 89177070 |
| Molecular Formula | C26H23I |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 7-[(E,1E)-1-(4-iodocyclohexa-2,4-dien-1-ylidene)pent-2-en-4-yn-2-yl]-9,9-dimethyl-3,4-dihydrofluorene |
| SMILES | C#C/C=C(\C=C1\C=CC(I)=CC1)c1ccc2c(c1)C(C)(C)C1=C2CCC=C1 |
| InChI | InChI=1S/C26H23I/c1-4-7-19(16-18-10-13-21(27)14-11-18)20-12-15-23-22-8-5-6-9-24(22)26(2,3)25(23)17-20/h1,6-7,9-10,12-17H,5,8,11H2,2-3H3/b18-16-,19-7+ |
| InChIKey | QXWARVMTHQZRTF-HOQTXEPBSA-N |
| XLogP | 7.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|