About 4,5-dimethyl-6-propan-2-yl-2,3-dihydro-1,4-oxazine
4,5-dimethyl-6-propan-2-yl-2,3-dihydro-1,4-oxazine (PubChem CID 89177113) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is 4,5-dimethyl-6-propan-2-yl-2,3-dihydro-1,4-oxazine.
Molecular Properties
| Compound Name | 4,5-dimethyl-6-propan-2-yl-2,3-dihydro-1,4-oxazine |
| PubChem CID | 89177113 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 4,5-dimethyl-6-propan-2-yl-2,3-dihydro-1,4-oxazine |
| SMILES | CC1=C(C(C)C)OCCN1C |
| InChI | InChI=1S/C9H17NO/c1-7(2)9-8(3)10(4)5-6-11-9/h7H,5-6H2,1-4H3 |
| InChIKey | BWCDUBSBQYXOJK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dimethyl-6-propan-2-yl-2,3-dihydro-1,4-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-6-propan-2-yl-2,3-dihydro-1,4-oxazine?
The IUPAC name of 4,5-dimethyl-6-propan-2-yl-2,3-dihydro-1,4-oxazine (CID 89177113) is 4,5-dimethyl-6-propan-2-yl-2,3-dihydro-1,4-oxazine.
What is the SMILES notation for 4,5-dimethyl-6-propan-2-yl-2,3-dihydro-1,4-oxazine?
The canonical SMILES for 4,5-dimethyl-6-propan-2-yl-2,3-dihydro-1,4-oxazine is CC1=C(C(C)C)OCCN1C.
What is the InChIKey of 4,5-dimethyl-6-propan-2-yl-2,3-dihydro-1,4-oxazine?
The InChIKey is BWCDUBSBQYXOJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO/c1-7(2)9-8(3)10(4)5-6-11-9/h7H,5-6H2,1-4H3.
What are the key properties of 4,5-dimethyl-6-propan-2-yl-2,3-dihydro-1,4-oxazine?
4,5-dimethyl-6-propan-2-yl-2,3-dihydro-1,4-oxazine has a molecular weight of 155.24 g/mol, XLogP of 1.84, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-6-propan-2-yl-2,3-dihydro-1,4-oxazine is sourced from PubChem (CID 89177113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).