C23H18F6O6 — CID 89177615
bis[2-(oxiran-2-ylmethyl)phenyl] 2,2,3,3,4,4-hexafluoropentanedioate (PubChem CID 89177615) has the molecular formula C23H18F6O6 and a molecular weight of 504.38 g/mol. Its IUPAC name is bis[2-(oxiran-2-ylmethyl)phenyl] 2,2,3,3,4,4-hexafluoropentanedioate.
| Compound Name | bis[2-(oxiran-2-ylmethyl)phenyl] 2,2,3,3,4,4-hexafluoropentanedioate |
|---|---|
| PubChem CID | 89177615 |
| Molecular Formula | C23H18F6O6 |
| Molecular Weight | 504.38 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | bis[2-(oxiran-2-ylmethyl)phenyl] 2,2,3,3,4,4-hexafluoropentanedioate |
| SMILES | O=C(Oc1ccccc1CC1CO1)C(F)(F)C(F)(F)C(F)(F)C(=O)Oc1ccccc1CC1CO1 |
| InChI | InChI=1S/C23H18F6O6/c24-21(25,19(30)34-17-7-3-1-5-13(17)9-15-11-32-15)23(28,29)22(26,27)20(31)35-18-8-4-2-6-14(18)10-16-12-33-16/h1-8,15-16H,9-12H2 |
| InChIKey | ZUJIDYIXTOWIGB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|