About 5-ethyl-N,N,4-trimethylcyclohexa-1,2,4-trien-1-amine
5-ethyl-N,N,4-trimethylcyclohexa-1,2,4-trien-1-amine (PubChem CID 89178685) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 5-ethyl-N,N,4-trimethylcyclohexa-1,2,4-trien-1-amine.
Analyze 5-ethyl-N,N,4-trimethylcyclohexa-1,2,4-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-N,N,4-trimethylcyclohexa-1,2,4-trien-1-amine?
The IUPAC name of 5-ethyl-N,N,4-trimethylcyclohexa-1,2,4-trien-1-amine (CID 89178685) is 5-ethyl-N,N,4-trimethylcyclohexa-1,2,4-trien-1-amine.
What is the SMILES notation for 5-ethyl-N,N,4-trimethylcyclohexa-1,2,4-trien-1-amine?
The canonical SMILES for 5-ethyl-N,N,4-trimethylcyclohexa-1,2,4-trien-1-amine is CCC1=C(C)C=C=C(N(C)C)C1.
What is the InChIKey of 5-ethyl-N,N,4-trimethylcyclohexa-1,2,4-trien-1-amine?
The InChIKey is FHZQXZMJUIEKRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-5-10-8-11(12(3)4)7-6-9(10)2/h6H,5,8H2,1-4H3.
What are the key properties of 5-ethyl-N,N,4-trimethylcyclohexa-1,2,4-trien-1-amine?
5-ethyl-N,N,4-trimethylcyclohexa-1,2,4-trien-1-amine has a molecular weight of 163.26 g/mol, XLogP of 2.72, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-N,N,4-trimethylcyclohexa-1,2,4-trien-1-amine is sourced from PubChem (CID 89178685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).