About azane;2-methyl-6-azabicyclo[3.1.0]hexa-1,3,5-triene
azane;2-methyl-6-azabicyclo[3.1.0]hexa-1,3,5-triene (PubChem CID 89179102) has the molecular formula C6H8N2
and a molecular weight of 108.14 g/mol. Its IUPAC name is azane;2-methyl-6-azabicyclo[3.1.0]hexa-1,3,5-triene.
Molecular Properties
| Compound Name | azane;2-methyl-6-azabicyclo[3.1.0]hexa-1,3,5-triene |
| PubChem CID | 89179102 |
| Molecular Formula | C6H8N2 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | azane;2-methyl-6-azabicyclo[3.1.0]hexa-1,3,5-triene |
| SMILES | Cc1ccc2nc1-2.N |
| InChI | InChI=1S/C6H5N.H3N/c1-4-2-3-5-6(4)7-5;/h2-3H,1H3;1H3 |
| InChIKey | ADPZBWKYWCMGBP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 47.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;2-methyl-6-azabicyclo[3.1.0]hexa-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-methyl-6-azabicyclo[3.1.0]hexa-1,3,5-triene?
The IUPAC name of azane;2-methyl-6-azabicyclo[3.1.0]hexa-1,3,5-triene (CID 89179102) is azane;2-methyl-6-azabicyclo[3.1.0]hexa-1,3,5-triene.
What is the SMILES notation for azane;2-methyl-6-azabicyclo[3.1.0]hexa-1,3,5-triene?
The canonical SMILES for azane;2-methyl-6-azabicyclo[3.1.0]hexa-1,3,5-triene is Cc1ccc2nc1-2.N.
What is the InChIKey of azane;2-methyl-6-azabicyclo[3.1.0]hexa-1,3,5-triene?
The InChIKey is ADPZBWKYWCMGBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N.H3N/c1-4-2-3-5-6(4)7-5;/h2-3H,1H3;1H3.
What are the key properties of azane;2-methyl-6-azabicyclo[3.1.0]hexa-1,3,5-triene?
azane;2-methyl-6-azabicyclo[3.1.0]hexa-1,3,5-triene has a molecular weight of 108.14 g/mol, XLogP of 1.53, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-methyl-6-azabicyclo[3.1.0]hexa-1,3,5-triene is sourced from PubChem (CID 89179102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).